|
|
| | 5-chloro-2,3-diMethylpyrazine Basic information |
| | 5-chloro-2,3-diMethylpyrazine Chemical Properties |
| Boiling point | 81℃ (18 Torr) | | density | 1.184±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 90.3±11.5℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C6H7ClN2/c1-4-5(2)9-6(7)3-8-4/h3H,1-2H3 | | InChIKey | MEWMQKSSLANHCR-UHFFFAOYSA-N | | SMILES | C1(C)=NC=C(Cl)N=C1C |
| RIDADR | UN1993 | | HS Code | 2933998090 |
| | 5-chloro-2,3-diMethylpyrazine Usage And Synthesis |
| | 5-chloro-2,3-diMethylpyrazine Preparation Products And Raw materials |
|