|
|
| | Aloe-eModin-8-O-β-D-glucopyranoside Basic information |
| Product Name: | Aloe-eModin-8-O-β-D-glucopyranoside | | Synonyms: | Aloe-eModin-8-O-β-D-glucopyranoside;Aloe-eModin-8-O-beta-D-glucopyranoside;Aloe Emodin 8-Glucoside;Aloe-emodin -8-O-β-D-glucoside;aleo-emodin-8-O-β-D-glucopyranoside;9,10-Anthracenedione, 8-(β-D-glucopyranosyloxy)-1-hydroxy-3-(hydroxymethyl)-;Emodin Impurity 10;Aloe-emodin-8-O-
glucopyranoside | | CAS: | 33037-46-6 | | MF: | C21H20O10 | | MW: | 432.38 | | EINECS: | | | Product Categories: | | | Mol File: | 33037-46-6.mol |  |
| | Aloe-eModin-8-O-β-D-glucopyranoside Chemical Properties |
| Melting point | 236-237℃ | | Boiling point | 829.9±65.0 °C(Predicted) | | density | 1.673±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO, Methanol (Slightly) | | pka | 6.48±0.20(Predicted) | | form | Solid | | color | Dark Orange to Dark Brown | | InChIKey | KIZBWUUJNJEYCM-XLXFRXGONA-N | | SMILES | c1cc2C(=O)c3cc(CO)cc(O)c3C(=O)c2c(O[C@H]2C(O)C(O)[C@H](O)C(CO)O2)c1 |&1:19,24,r| |
| | Aloe-eModin-8-O-β-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | Pale yellow powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Polygonum multiflorum and Rhubarb. | | Uses | Aloe Emodin 8-Glucoside is a anthraquinone glycoside that was investigated for antioxidant activities and neuroprotective properties. |
| | Aloe-eModin-8-O-β-D-glucopyranoside Preparation Products And Raw materials |
|