BROMOMETHYL ACETATE manufacturers
- brommethylacetat
-
- $2.00 / 1KG
-
2019-12-23
- CAS:590-97-6
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 100kg
|
| | BROMOMETHYL ACETATE Basic information |
| | BROMOMETHYL ACETATE Chemical Properties |
| Melting point | 139-140.5 °C | | Boiling point | 130-133 °C/750 mmHg (lit.) | | density | 1.56 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.447(lit.) | | RTECS | AF6300200 | | Fp | 135 °F | | storage temp. | 2-8°C | | solubility | Miscible with chloroform. | | form | Crystalline Powder or Powder | | color | White to light beige | | Sensitive | Moisture Sensitive | | Stability: | Hygroscopic, Moisture Sensitive, Volatile | | InChI | InChI=1S/C3H5BrO2/c1-3(5)6-2-4/h2H2,1H3 | | InChIKey | NHYXMAKLBXBVEO-UHFFFAOYSA-N | | SMILES | C(OC(=O)C)Br | | CAS DataBase Reference | 590-97-6(CAS DataBase Reference) | | EPA Substance Registry System | Methanol, bromo-, acetate (590-97-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-45 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29153900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | BROMOMETHYL ACETATE Usage And Synthesis |
| Chemical Properties | Clear colorless to yellow liquid | | Uses | Bromomethyl acetate is involved in the preparation of optically active cyclohexene antisepsis agents. It acts as reagent in samarium diiodide-mediated conversion of ketones and aldehydes to 1,2-diacetates. | | Uses | Has cytotoxicity and mutagenicity effects. | | General Description | The interaction of bromomethyl acetate with O(6)-alkylguanine-DNA alkyltransferase (DNA repair protein) was studied in vitro. |
| | BROMOMETHYL ACETATE Preparation Products And Raw materials |
|