4-[3-(TrifluoroMethyl)-3H-diazirin-3-yl]benzyl Alcohol manufacturers
|
| | 4-[3-(TrifluoroMethyl)-3H-diazirin-3-yl]benzyl Alcohol Basic information |
| | 4-[3-(TrifluoroMethyl)-3H-diazirin-3-yl]benzyl Alcohol Chemical Properties |
| Boiling point | 269.2±50.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | refractive index | 1.4770 to 1.4810 | | storage temp. | 2-8°C(protect from light) | | solubility | Dichloromethane, Diethyl Ether, Methanol | | form | Oil | | pka | 14.30±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C9H7F3N2O/c10-9(11,12)8(13-14-8)7-3-1-6(5-15)2-4-7/h1-4,15H,5H2 | | InChIKey | UZHHTEASLDJYBO-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(C2(C(F)(F)F)N=N2)C=C1 |
| | 4-[3-(TrifluoroMethyl)-3H-diazirin-3-yl]benzyl Alcohol Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | 4-[3-(Trifluoromethyl)-3H-diazirin-3-yl]benzyl Alcohol is a photoaffinity reagent. Photo-induced crosslinking reagent. |
| | 4-[3-(TrifluoroMethyl)-3H-diazirin-3-yl]benzyl Alcohol Preparation Products And Raw materials |
|