|
|
| | (αS)-α-AMino-benzenebutanoic Acid Methyl Ester Hydrochloride Basic information |
| | (αS)-α-AMino-benzenebutanoic Acid Methyl Ester Hydrochloride Chemical Properties |
| Melting point | 159-160 °C (decomp)(Solv: methanol (67-56-1); ethyl ether (60-29-7)) | | storage temp. | Store at room temperature, keep dry and cool | | solubility | soluble in DMSO, Ethanol, Methanol, Water | | form | White Solild | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C11H15NO2.ClH/c1-14-11(13)10(12)8-7-9-5-3-2-4-6-9;/h2-6,10H,7-8,12H2,1H3;1H/t10-;/s3 | | InChIKey | PZKOPSSMUBBHMM-MEQOOBBNNA-N | | SMILES | c1(ccccc1)CC[C@@H](N)C(=O)OC.Cl |&1:8,r| |
| | (αS)-α-AMino-benzenebutanoic Acid Methyl Ester Hydrochloride Usage And Synthesis |
| Chemical Properties | White Solild |
| | (αS)-α-AMino-benzenebutanoic Acid Methyl Ester Hydrochloride Preparation Products And Raw materials |
|