|
|
| | 5-[(2-Chloroethyl)(2-hydroxyethyl)aMino]-1-Methyl-1H-benziMidazole-2-butanoic Acid Basic information |
| | 5-[(2-Chloroethyl)(2-hydroxyethyl)aMino]-1-Methyl-1H-benziMidazole-2-butanoic Acid Chemical Properties |
| storage temp. | 2-8°C | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C16H22ClN3O3/c1-19-14-6-5-12(20(8-7-17)9-10-21)11-13(14)18-15(19)3-2-4-16(22)23/h5-6,11,21H,2-4,7-10H2,1H3,(H,22,23) | | InChIKey | PFTRYOMJJKBZKV-UHFFFAOYSA-N | | SMILES | C1(CCCC(O)=O)N(C)C2=CC=C(N(CCCl)CCO)C=C2N=1 |
| WGK Germany | WGK 3 | | HS Code | 2933997500 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Muta. 2 Repr. 1B |
| | 5-[(2-Chloroethyl)(2-hydroxyethyl)aMino]-1-Methyl-1H-benziMidazole-2-butanoic Acid Usage And Synthesis |
| Uses | Hydroxy Bendamustine is a metabolite of Bendamustine (B132500). |
| | 5-[(2-Chloroethyl)(2-hydroxyethyl)aMino]-1-Methyl-1H-benziMidazole-2-butanoic Acid Preparation Products And Raw materials |
|