| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
| Company Name: |
parabiochem |
| Tel: |
025-83453382-8005 |
| Email: |
sale@parabiochem.com |
|
| | ethyl 4,5-diMethyl-1H-pyrazole-3-carboxylate Basic information |
| | ethyl 4,5-diMethyl-1H-pyrazole-3-carboxylate Chemical Properties |
| Boiling point | 309.8±37.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.55±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H12N2O2/c1-4-12-8(11)7-5(2)6(3)9-10-7/h4H2,1-3H3,(H,9,10) | | InChIKey | NFKJSKVAOLQEDS-UHFFFAOYSA-N | | SMILES | N1C(C)=C(C)C(C(OCC)=O)=N1 |
| | ethyl 4,5-diMethyl-1H-pyrazole-3-carboxylate Usage And Synthesis |
| | ethyl 4,5-diMethyl-1H-pyrazole-3-carboxylate Preparation Products And Raw materials |
|