| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine Basic information |
| Product Name: | 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine | | Synonyms: | 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine;2,4(1H,3H)-PyriMidinedione, 1-[4-C-azido-2-deoxy-2-fluoro-b-D-arabinofuranosyl]-;4'-Azido-2'-deoxy-2'-fluoro-beta-D-arabino ribofuranosyl uracil;4'-Azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine;1-[4-C-Azido-2-deoxy-2-fluoro-beta-D-arabinofuranosyl]-2,4(1H,3H)-pyrimidinedione;4'-Azido-2'-deoxy-2'-fluoro-beta-D-arabinofuranosyl uracil;4'-C-Azido-2'-deoxy-2'-fluoro-b-D-arabinouridine;4’-Azido-2’-deoxy-2’-fluoro-β-D-arabinouridine | | CAS: | 173379-73-2 | | MF: | C9H10FN5O5 | | MW: | 287.21 | | EINECS: | | | Product Categories: | | | Mol File: | 173379-73-2.mol |  |
| | 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine Chemical Properties |
| InChI | InChI=1/C9H10FN5O5/c10-5-6(18)9(3-16,13-14-11)20-7(5)15-2-1-4(17)12-8(15)19/h1-2,5-7,16,18H,3H2,(H,12,17,19)/t5-,6-,7+,9+/s3 | | InChIKey | SNWCOSVWPQSOEU-BODDTQOYNA-N | | SMILES | N([C@]1([C@H]([C@H](F)[C@H](N2C=CC(=O)NC2=O)O1)O)CO)=[N+]=[N-] |&1:1,2,3,5,r| |
| | 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine Usage And Synthesis |
| Uses | 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a uridine analogue. Uridine has potential antiepileptic effects, and its analogs can be used to study anticonvulsant and anxiolytic activities, as well as to develop new antihypertensive agents[1]. 4’-Azido-2’-deoxy-2’-fluoro-beta-D-arabinouridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | References | [1] Connolly GP, et al. Uridine and its nucleotides: biological actions, therapeutic potentials. Trends Pharmacol Sci. 1999 May;20(5):218-25. DOI:10.1016/s0165-6147(99)01298-5 |
| | 4'-C-azido-2'-deoxy-2'-fluoro-beta-D-arabinouridine Preparation Products And Raw materials |
|