| Company Name: |
ChemeGen Gold |
| Tel: |
18818260767 |
| Email: |
2625930290@qq.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
| Company Name: |
Novachemistry |
| Tel: |
44-20819178-90 02081917890 |
| Email: |
info@novachemistry.com |
|
| | Rubiginone D2 Basic information |
| Product Name: | Rubiginone D2 | | Synonyms: | Rubiginone D2;(2S,3S,4R)-3,4-Dihydro-2,4-dihydroxy-8-methoxy-3-methylbenz[a]anthracene-1,7,12(2H)-trione;Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-2,4-dihydroxy-8-methoxy-3-methyl-, (2S,3S,4R)- | | CAS: | 274913-71-2 | | MF: | C20H16O6 | | MW: | 352.34 | | EINECS: | | | Product Categories: | | | Mol File: | 274913-71-2.mol |  |
| | Rubiginone D2 Chemical Properties |
| Boiling point | 639.5±55.0 °C(Predicted) | | density | 1.465±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 12.58±0.60(Predicted) | | form | A solid | | color | Yellow solid with a green cast | | InChI | InChI=1S/C20H16O6/c1-8-16(21)10-6-7-11-14(15(10)20(25)17(8)22)19(24)9-4-3-5-12(26-2)13(9)18(11)23/h3-8,16-17,21-22H,1-2H3/t8-,16+,17-/m0/s1 | | InChIKey | DWIWLEGGRHIXAH-KDLNQGCSSA-N | | SMILES | C12C(=O)[C@@H](O)[C@@H](C)[C@@H](O)C1=CC=C1C=2C(=O)C2=C(C(OC)=CC=C2)C1=O |
| | Rubiginone D2 Usage And Synthesis |
| Uses | Rubiginone D2 is an antibiotic, which exhibits antimicrobial activities against Bacillus subtilis, Staphylococcus aureus and Escherichia coli. Rubiginone D2 exhibits antitumor efficacy, inhibits proliferations of cancer cells HM02, Kato III, HepG2 and MCF7, with GI50s of 0.1, 0.7, <0.1 and 7.5 μM, respectively[1]. | | storage | +4°C | | References | [1] Puder C, et al., New biologically active rubiginones from Streptomyces sp. J Antibiot (Tokyo). 2000 Apr;53(4):329-36. DOI:10.7164/antibiotics.53.329 |
| | Rubiginone D2 Preparation Products And Raw materials |
|