|
|
| | (2R,5R)-1,6-Diphenylhexane-2,5-diaMine dihydrochloride Basic information |
| Product Name: | (2R,5R)-1,6-Diphenylhexane-2,5-diaMine dihydrochloride | | Synonyms: | (2R,5R)-1,6-Diphenylhexane-2,5-diaMine dihydrochloride;(2R,5R)-1,6-Diphenyl-2,5-hexanediaMine hydrochloride;(2R,5R)-1,6-diphenylhexane-2,5-diaMine;2,5-Hexanediamine, 1,6-diphenyl-, hydrochloride (1:2), (2R,5R)-;(2R,5R)-1,6-DIPHENYLHEXANE-2,5-DIAMINE 2HCL;(2R,5R)-1,6-Diphenylhexane-2,5-diamine 2 Hydrochloric Acid Salt;FAVORITES COMPARE (2R,5R)-1,6-DIPHENYLHEXANE-2,5-DIAMINE DIHYDROCHLORIDE 1247119-31-8;(2R,5R)-1,6-Diphenyl-hexane-2,5-Diamine,?dihydrogen?chloride | | CAS: | 1247119-31-8 | | MF: | C18H25ClN2 | | MW: | 304.8575 | | EINECS: | 700-856-1 | | Product Categories: | ANTI HIV INT. | | Mol File: | 1247119-31-8.mol |  |
| | (2R,5R)-1,6-Diphenylhexane-2,5-diaMine dihydrochloride Chemical Properties |
| Melting point | >200°C (Dec.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly, Heated, Sonicated), Methanol (Slightly), Water (Slightly, Heated | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C18H24N2.2ClH/c19-17(13-15-7-3-1-4-8-15)11-12-18(20)14-16-9-5-2-6-10-16;;/h1-10,17-18H,11-14,19-20H2;2*1H/t17-,18-;;/s3 | | InChIKey | XTTBTZPGZLVADL-UUYNVSLBNA-N | | SMILES | C(C1=CC=CC=C1)[C@H](N)CC[C@@H](N)CC1=CC=CC=C1.[H]Cl.[H]Cl |&1:7,11,r| |
| | (2R,5R)-1,6-Diphenylhexane-2,5-diaMine dihydrochloride Usage And Synthesis |
| | (2R,5R)-1,6-Diphenylhexane-2,5-diaMine dihydrochloride Preparation Products And Raw materials |
|