|
|
| | 2-（3-Bromophenyl）triphenylene Basic information |
| Product Name: | 2-（3-Bromophenyl）triphenylene | | Synonyms: | 2-(3-broMophenyl)triphenylene;Triphenylene, 2-(3-bromophenyl)-;2-(tribromophenyl)triphenylene;2-(3-Bromophenyl)triphenylene >;2-(tribromophenyl) sanybenzene;Bromophenyltriphenylene;2-(3-Bromophenyl)phenanthrene | | CAS: | 1313514-53-2 | | MF: | C24H15Br | | MW: | 383.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1313514-53-2.mol |  |
| | 2-（3-Bromophenyl）triphenylene Chemical Properties |
| Melting point | 147.0 to 151.0 °C | | Boiling point | 556.4±19.0 °C(Predicted) | | density | 1.402±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Yellow to Orange | | InChI | InChI=1S/C24H15Br/c25-18-7-5-6-16(14-18)17-12-13-23-21-10-2-1-8-19(21)20-9-3-4-11-22(20)24(23)15-17/h1-15H | | InChIKey | KWXFBIBEVROWEF-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C4C2=CC=CC=4)=CC=CC=3)=CC=C1C1=CC=CC(Br)=C1 |
| | 2-（3-Bromophenyl）triphenylene Usage And Synthesis |
| Chemical Properties | Class white powder | | Uses | 2-（3-Bromophenyl）triphenylene is a moiety with an activated electron that has quantum efficiency as high as thermally. It can be used to make devices such as light emitting diodes (LEDs) and photodetectors. 2-（3-Bromophenyl）triphenylene has been shown to have low efficiency in fluorescent devices, but it can be stacked with other compounds to increase the efficiency of phosphorescent devices. |
| | 2-（3-Bromophenyl）triphenylene Preparation Products And Raw materials |
|