|
|
| | 1-Methylcylohexantyl-2-Methacrylate Basic information |
| Product Name: | 1-Methylcylohexantyl-2-Methacrylate | | Synonyms: | 1-Methylcylohexantyl-2-Methacrylate;1-Methyl-1-cyclohexyl Methacrylate;1-methylcylohexantyl-methacrylate;1-methylcyclohexyl methacrylate;1-Methylcyclohexyl methacrylate Factory ArF monomers;1-Methylcyclohexyl methacrylate 76392-14-8;1-Methyl-1-cyclohexyl methacrylate 76392-14-8;2-Propenoic acid, 2-methyl-, 1-methylcyclohexyl ester | | CAS: | 76392-14-8 | | MF: | C11H18O2 | | MW: | 182.26 | | EINECS: | | | Product Categories: | | | Mol File: | 76392-14-8.mol |  |
| | 1-Methylcylohexantyl-2-Methacrylate Chemical Properties |
| Boiling point | 227.5±9.0℃ (760 Torr) | | density | 0.95±0.1 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4605 (589.3 nm 20℃) | | Fp | 85.9±16.1℃ | | InChI | InChI=1S/C11H18O2/c1-9(2)10(12)13-11(3)7-5-4-6-8-11/h1,4-8H2,2-3H3 | | InChIKey | LBHPSYROQDMVBS-UHFFFAOYSA-N | | SMILES | C(OC1(C)CCCCC1)(=O)C(C)=C |
| | 1-Methylcylohexantyl-2-Methacrylate Usage And Synthesis |
| Uses | 1-Methylcylohexantyl-2-Methacrylate (MCHMA) can be used as photoresist monomer. |
| | 1-Methylcylohexantyl-2-Methacrylate Preparation Products And Raw materials |
|