1-(5-Hydroxypyrazin-2-yl)ethanone manufacturers
|
| | 1-(5-Hydroxypyrazin-2-yl)ethanone Basic information |
| | 1-(5-Hydroxypyrazin-2-yl)ethanone Chemical Properties |
| density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 10.62±0.40(Predicted) | | InChI | InChI=1S/C6H6N2O2/c1-4(9)5-2-8-6(10)3-7-5/h2-3H,1H3,(H,8,10) | | InChIKey | QKRGMTSGTKSZHX-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(C(C)=O)N=C1 |
| | 1-(5-Hydroxypyrazin-2-yl)ethanone Usage And Synthesis |
| Uses | 1-(5-Hydroxypyrazin-2-yl)ethanone can be used as a key intermediate in the synthesis of pharmaceuticals, particularly in the development of kinase inhibitors for cancer treatment. |
| | 1-(5-Hydroxypyrazin-2-yl)ethanone Preparation Products And Raw materials |
|