|
|
| | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine Basic information |
| Product Name: | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine | | Synonyms: | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine;2,4,6-Tris(2,4-Dihydroxyphenyl)-s-triazine;Tris(2,4-dihydroxyphenyl)-1,3,5-triazine;4-[4,6-di-(2,4-di-hydroxyphenyl)-1,3,5-triazin2-yl]-benzene-1,3-diol;1,3-Benzenediol, 4,4',4''-(1,3,5-triazine-2,4,6-triyl)tris-;4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tris(benzene-1,3-diol);4-[4,6-Bis(2,4-dihydroxyphenyl)-1,3,5-triazin-2-yl]-1,3-benzenediol;1,3- Benzenediol 4,4,4-(1,3,5 triazine)-2,4,6 tris (Appolo-459) | | CAS: | 2125-23-7 | | MF: | C21H15N3O6 | | MW: | 405.36 | | EINECS: | 700-796-6 | | Product Categories: | 1 | | Mol File: | 2125-23-7.mol |  |
| | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine Chemical Properties |
| Melting point | <300℃ | | Boiling point | 842.6±68.0 °C(Predicted) | | density | 1.586±0.06 g/cm3(Predicted) | | pka | 8.00±0.40(Predicted) | | form | Powder | | InChI | InChI=1S/C21H15N3O6/c25-10-1-4-13(16(28)7-10)19-22-20(14-5-2-11(26)8-17(14)29)24-21(23-19)15-6-3-12(27)9-18(15)30/h1-9,25-30H | | InChIKey | SGZWJGRZDJCDIM-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=C(O)C=C2O)N=C(C2=CC=C(O)C=C2O)N=C1C1=CC=C(O)C=C1O | | LogP | -0.51-2.733 at 25℃ |
| | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine Usage And Synthesis |
| Description | 2,4,6-Tris(2,4-dihydroxyphenyl)-1,3,5-triazine is an ultraviolet (UV) absorber intermediate with excellent performance. It is mainly used in aspects such as polyvinyl chloride agricultural film, engineering plastics, latex and varnish colour, owing to its high-efficiency UV absorption capacity, radiation protection properties, and biological activity.[1] | | References |
[1] Song, X., Zhang, Z., Tudi, R., Yasen, A., Xiang, M., & Abulimiti, B. (2026). The mechanism of excited-state proton transfer of 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine in dimethyl sulfoxide solution. Chemical Physics, 604, Article 113096. https://doi.org/10.1016/j.chemphys.2026.113096
|
| | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine Preparation Products And Raw materials |
|