| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 3,3-difluoro-5-hydroxypiperidin-2-one Basic information |
| | 3,3-difluoro-5-hydroxypiperidin-2-one Chemical Properties |
| Melting point | 136.2 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 309.7±42.0 °C(Predicted) | | density | 1.41±0.1 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 11.91±0.60(Predicted) | | InChI | InChI=1S/C5H7F2NO2/c6-5(7)1-3(9)2-8-4(5)10/h3,9H,1-2H2,(H,8,10) | | InChIKey | IGLPGCSKRIFQMC-UHFFFAOYSA-N | | SMILES | N1CC(O)CC(F)(F)C1=O |
| | 3,3-difluoro-5-hydroxypiperidin-2-one Usage And Synthesis |
| Uses | 3,3-Difluoro-5-hydroxypiperidin-2-one is one of the high interest building blocks in medicinal chemistry. |
| | 3,3-difluoro-5-hydroxypiperidin-2-one Preparation Products And Raw materials |
|