| Company Name: |
Shanghai Renshi Pharmatech Co., LTD
|
| Tel: |
021-61150625 18521367657 |
| Email: |
info@renshipharma.com |
| Products Intro: |
Product Name:1,3-Dimethyl-2-(trifluoromethyl)benzene CAS:41818-96-6 Purity:98% Package:10g;100g;1kg
|
| Company Name: |
Cochemical Ltd.
|
| Tel: |
029-86115547 17791676824 |
| Email: |
sales@cochemical.com |
| Products Intro: |
Product Name:1,3-Dimethyl-2-(trifluoromethyl)benzene CAS:41818-96-6 Purity:96% HMNR Package:1G;5G;15G;100g;1kg
|
|
| | 1,3-Dimethyl-2-(trifluoromethyl)benzene Basic information |
| | 1,3-Dimethyl-2-(trifluoromethyl)benzene Chemical Properties |
| InChI | InChI=1S/C9H9F3/c1-6-4-3-5-7(2)8(6)9(10,11)12/h3-5H,1-2H3 | | InChIKey | BGURHJHQZVSCHL-UHFFFAOYSA-N | | SMILES | C1(C)=CC=CC(C)=C1C(F)(F)F |
| | 1,3-Dimethyl-2-(trifluoromethyl)benzene Usage And Synthesis |
| | 1,3-Dimethyl-2-(trifluoromethyl)benzene Preparation Products And Raw materials |
|