|
|
| | 24-Hydroxycholesterol Basic information |
| | 24-Hydroxycholesterol Chemical Properties |
| Boiling point | 513.1±23.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 15.03±0.70(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | IOWMKBFJCNLRTC-APZZRWHHNA-N | | SMILES | C1C[C@]2(C)[C@H]3CC[C@]4(C)[C@H]([C@@H](C)CCC(O)C(C)C)CC[C@H]4[C@@H]3CC=C2C[C@H]1O |&1:2,4,7,9,10,21,22,27,r| |
| | 24-Hydroxycholesterol Usage And Synthesis |
| Uses | 24-Hydroxycholesterol is the main cholesterol elimination product of the brain and was found to be increased in serum of Alzheimer patients. | | Definition | ChEBI: 24-hydroxycholesterol is an oxysterol that is cholesterol which is substituted by a hydroxy group at position 24. It is a 24-hydroxy steroid, an oxysterol and a 3beta-hydroxy-Delta(5)-steroid. It is functionally related to a cholesterol. | | in vivo | Hypoxia inducible factor-1a (HIF-1α) controls the overexpression of the enzyme Cyp46a1, which generates the oxysterol 24-hydroxycholesterol in a pancreatic neuroendocrine tumor (pNET) model commonly used to study neoangiogenesis. The activation of the HIF-1α-24S-HC axis ultimately leads to the induction of the angiogenic switch through the positioning of proangiogenic neutrophils in proximity to Cyp46a1+ islets[1]. 24-hydroxycholesterol levels are increased at 2-4 months in the untreated 5XFAD mouse brain and then became similar to those in the B6SJL mouse brain[2]. | | IC 50 | NMDA Receptor |
| | 24-Hydroxycholesterol Preparation Products And Raw materials |
|