|
|
| | 3-HYDROXY DESLORATADINE HCL Basic information |
| Product Name: | 3-HYDROXY DESLORATADINE HCL | | Synonyms: | 3-HYDROXY DESLORATADINE HCL;8-Chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-3-ol;Sch 45581;8-Chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo[5,6]cyclohepta[1,2-β]pyridin-3-ol;5H-Benzo[5,6]cyclohepta[1,2-b]pyridin-3-ol, 8-chloro-6,11-dihydro-11-(4-piperidinylidene)-;Loratadine Desethoxycarbonyl 3-Hydroxy IMpurity;3-OH-desloratadine-D4 Hbr;Desloratadine 3-Hydroxy Impurity | | CAS: | 119410-08-1 | | MF: | C19H19ClN2O | | MW: | 326.82 | | EINECS: | 218-362-5 | | Product Categories: | Heterocycles;Various Metabolites and Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 119410-08-1.mol |  |
| | 3-HYDROXY DESLORATADINE HCL Chemical Properties |
| Melting point | 169-171°C | | Boiling point | 575.2±50.0 °C(Predicted) | | density | 1.292 | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | DMF: 10 mg/ml; DMF:PBS(pH 7.2)(1:6): 0.14 mg/ml; DMSO: 10 mg/ml; Ethanol: 5 mg/ml | | form | A crystalline solid | | pka | 9.27±0.20(Predicted) | | color | pale yellow to off-white | | InChI | 1S/C19H19ClN2O/c20-15-3-4-17-13(9-15)1-2-14-10-16(23)11-22-19(14)18(17)12-5-7-21-8-6-12/h3-4,9-11,21,23H,1-2,5-8H2 | | InChIKey | NDFMTPISBHBIKE-UHFFFAOYSA-N | | SMILES | Clc1cc2c(cc1)C(=C4CCNCC4)c3ncc(cc3CC2)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-HYDROXY DESLORATADINE HCL Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | 3-Hydroxy Desloratadine is an active metabolite of Loratadine. | | Biological Activity | 3-hydroxydesloratadine formation involves the oxidation of desloratadine by cytochrome P450 (CYP2C8) and subsequent glucuronidation by UDP-glucuronosyltransferase UGT2B10 in cryopreserved human hepatocytes. This pathway leads to the production of 3-hydroxydesloratadine, a major active human metabolite. |
| | 3-HYDROXY DESLORATADINE HCL Preparation Products And Raw materials |
|