2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- manufacturers
|
| | 2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- Basic information |
| Product Name: | 2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- | | Synonyms: | 2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]-;Decarbonyl Rivaroxaban;Imp. G:5-chloro-N-((2R)-2-hydroxy-3-{[4-(3-oxo-4-morpholinyl)-phenyl]amino}propyl)-2-thiophenecarboxamide;Rivaroxaban impurity P4D-P;Rivaroxaban Descarbonyl Impurity;Rivaroxaban L;5-chloro-N-((2R)-2-hydroxy-3-{[4-(3-oxo-4-morpholinyl)-phenyl]amino}propyl)-2-thiophenecarboxamide;Rivaroxaban Impurity 12/Decarbonyl Rivaroxaban/Rivaroxaban Impurity G | | CAS: | 721401-53-2 | | MF: | C18H20ClN3O4S | | MW: | 409.89 | | EINECS: | | | Product Categories: | | | Mol File: | 721401-53-2.mol | ![2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- Structure](CAS/20150408/GIF/721401-53-2.gif) |
| | 2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- Chemical Properties |
| Melting point | >188°C (dec.) | | Boiling point | 772.6±60.0 °C(Predicted) | | density | 1.434±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 13.65±0.46(Predicted) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | Major Application | pharmaceutical small molecule | | InChI | 1S/C18H20ClN3O4S/c19-16-6-5-15(27-16)18(25)21-10-14(23)9-20-12-1-3-13(4-2-12)22-7-8-26-11-17(22)24/h1-6,14,20,23H,7-11H2,(H,21,25)/t14-/m1/s1 | | InChIKey | OKMRQXXUAFSBCM-CQSZACIVSA-N | | SMILES | [s]1c(ccc1C(=O)NC[C@H](O)CNc2ccc(cc2)N3CCOCC3=O)Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- Usage And Synthesis |
| Uses | Decarbonyl Rivaroxaban is an impurity of Rivaroxaban (R538000), which is a novel antithrombotic agent. A highly potent and selective, direct FXa inhibitor. |
| | 2-ThiophenecarboxaMide, 5-chloro-N-[(2R)-2-hydroxy-3-[[4-(3-oxo-4-Morpholinyl)phenyl]aMino]propyl]- Preparation Products And Raw materials |
|