| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:(3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt
CAS:60237-34-5
Package:100Mg,10Mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:(3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid Disodium Salt
CAS:60237-34-5
Purity:NULL Package:100mg;10mg Remarks:NULL
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
cindy.yang@lgcgroup.com |
| Products Intro: |
Product Name:(3a,5b,7a)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid Disodium Salt
CAS:60237-34-5
Purity:具体纯度，见COA Package:100mg Remarks:TRC-H954025
|
| Company Name: |
Shanghai Beiwanta Biotechnology Co., Ltd.
|
| Tel: |
021-67187366 19901745723 |
| Email: |
info@bwtlab.com |
| Products Intro: |
Product Name:Chenodeoxycholic acid 3-sulfate disodium salt
CAS:60237-34-5
Purity:95+ Package:1mg;5mg;10mg;20mg
|
|
| | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt Basic information |
| Product Name: | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt | | Synonyms: | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt;Chenodeoxycholic acid 3-sulfate disodium salt;(3α.5β.7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid Disodium Salt;(3a,5b,7a)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid Disodium Salt;(3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid Disodium Salt, CAS 60237-34-5 | | CAS: | 60237-34-5 | | MF: | C24H41NaO7S | | MW: | 496.63 | | EINECS: | | | Product Categories: | | | Mol File: | 60237-34-5.mol |  |
| | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt Chemical Properties |
| Melting point | 203-208°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | DIZNBCQKAASHQT-OHXJQDLJNA-N | | SMILES | O[C@@H]1C[C@]2([H])C[C@H](OS(O)(=O)=O)CC[C@]2(C)[C@@]2([H])CC[C@@]3([C@@]([H])([C@H](C)CCC(=O)O)CC[C@@]3([H])[C@]12[H])C.[NaH] |&1:1,3,6,14,16,20,21,23,32,34,r| |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt Usage And Synthesis |
| Uses | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid is the 3-monosulfate derivative of chenodeoxycholic acid (C291900), a major bile acid in many vertebrates, occurring as the N-glycine and/or N-taurine conjugate. |
| | (3α,5β,7α)-7-Hydroxy-3-(sulfooxy)-cholan-24-oic Acid DisodiuM Salt Preparation Products And Raw materials |
|