|
|
| | Ivabradine IMpurity Basic information |
| Product Name: | Ivabradine IMpurity | | Synonyms: | Ivabradine IMpurity;3-O-Desmethyl Ivabradine;Ivabradine Impurity 12;(S)-2-(2-(2-((3-(((3,4-dimethoxybicyclo[4.2.0]octa-1(6),2,4-trien-7-yl)methyl)(methyl)amino)propyl)amino)ethyl)-4,5-dimethoxyphenyl)acetic acid hydrochloride;(R)-3-(3-(((3,4-dimethoxybicyclo[4.2.0]octa-1(6),2,4-trien-7-yl)methyl)(methyl)amino)propyl)-7,8-dimethoxy-4,5-dihydro-1H-benzo[d]azepin-2(3H)-one hydrochloride;3-(3-((2-(3,4-dimethoxyphenyl)propyl)(methyl)amino)propyl)-7,8-dimethoxy-4,5-dihydro-1H-benzo[d]azepin-2(3H)-one hydrochloride;Ivabradine IMpurity Y1021;Hydrochloride Ivabradine IMP | | CAS: | 1616710-50-9 | | MF: | C27H35ClN2O6 | | MW: | 519.0296 | | EINECS: | | | Product Categories: | DCP | | Mol File: | 1616710-50-9.mol |  |
| | Ivabradine IMpurity Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Light Yellow | | InChIKey | GSZCZNYQYXAECA-JHTMQSDJNA-N | | SMILES | N1(CCCN(C)C[C@H]2CC3C2=CC(OC)=C(OC)C=3)C(=O)C(=O)C2=CC(OC)=C(OC)C=C2CC1.[H]Cl |&1:7,r| |
| | Ivabradine IMpurity Usage And Synthesis |
| Uses | 2-Oxo-ivabradine Hydrochloride is an impurity of Ivabradine Hydrochloride (I940500) which is a selective bradycardic agent with direct effect on the pacemaker If current of the sinoatrial node. Antianginal. |
| | Ivabradine IMpurity Preparation Products And Raw materials |
|