2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine manufacturers
- 2-Butyl EDOT
-
-
2026-05-27
- CAS:552857-06-4
- Min. Order: 1Kg/Bag
- Purity: 99% up, High Density
- Supply Ability: 20 tons
|
| | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine Basic information |
| Product Name: | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine | | Synonyms: | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine;Thieno[3,4-b]-1,4-dioxin, 2-butyl-2,3-dihydro-;2-Butyl EDOT;2-Butyl-2,3-dihydrothieno[3,4-b][1,4]dioxine | | CAS: | 552857-06-4 | | MF: | C10H14O2S | | MW: | 198.28 | | EINECS: | | | Product Categories: | | | Mol File: | 552857-06-4.mol | ![2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine Structure](CAS/20150408/GIF/552857-06-4.gif) |
| | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine Chemical Properties |
| Boiling point | 269.7±19.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C10H14O2S/c1-2-3-4-8-5-11-9-6-13-7-10(9)12-8/h6-8H,2-5H2,1H3 | | InChIKey | NNIKSVAOFGELNT-UHFFFAOYSA-N | | SMILES | O1C(CCCC)COC2=CSC=C12 |
| | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine Usage And Synthesis |
| Synthesis | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine was synthesised by the reaction of 2,3-dimethoxythiophene and Hexane-1,2-diol with toluene-4-sulphonic acid in toluene at 85 °C.
![2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine synthesis 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine synthesis](/NewsImg/2024-02-06/6384282429778493209586581.png)
|
| | 2-Butyl-2,3-dihydrothieno[3,4-b]-1,4-dioxine Preparation Products And Raw materials |
|