- BisfluoroModafinil
-
-
2026-08-08
- CAS:90280-13-0
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10T
- BisfluoroModafinil
-
- $1.00
-
2026-06-26
- CAS:90280-13-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200KG
|
| Product Name: | BisfluoroModafinil | | Synonyms: | BisfluoroModafinil;CRL-40,90;Acetamide, 2-[[bis(4-fluorophenyl)methyl]sulfinyl]-;CRL-40,940/Flmodafinil;CAS90280-13-0 Nootropics Flmodafinil / CRL-40,940;CRL-40,940 lauflumide;Nootropics Flmodafinil;Flmodafinil/CRL-40,940 | | CAS: | 90280-13-0 | | MF: | C15H13F2NO2S | | MW: | 309.33 | | EINECS: | 100-502-1 | | Product Categories: | | | Mol File: | 90280-13-0.mol |  |
| | BisfluoroModafinil Chemical Properties |
| Melting point | 78-80 °C | | Boiling point | 558.7±50.0 °C(Predicted) | | density | 1.397±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 100 mg/mL (323.28 mM; Need ultrasonic) | | form | Solid | | pka | 14.82±0.40(Predicted) | | color | White to off-white | | InChI | InChI=1S/C15H13F2NO2S/c16-12-5-1-10(2-6-12)15(21(20)9-14(18)19)11-3-7-13(17)8-4-11/h1-8,15H,9H2,(H2,18,19) | | InChIKey | YEAQNUMCWMRYMU-UHFFFAOYSA-N | | SMILES | C(N)(=O)CS(C(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1)=O |
| | BisfluoroModafinil Usage And Synthesis |
| Description | Bisfluoromodafinil (also known as CRL-40,940, flmodafinil, and lauflumide) is the bisfluoro analog of modafinil. It is the newest and strongest nootropic. It helps to enhance the mental intelligence and the motivation level. It improves brain power to solve problems and protects it from any chemical or physical injury. It can be used to treat attention deficit disorders, sleep disorders, and mild depression.
| | Uses | 2-[[Bis(4-fluorophenyl)methyl]sulfinyl]acetamide is used in the preparation of lauflumide and its enantiomers and their use for treating attention deficit hyperactivity disorder, narcolepsy and idiopathic hypersomnia. |
| | BisfluoroModafinil Preparation Products And Raw materials |
|