| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(Di(adamantan-1-yl)phosphino)-1',3',5'-triphenyl-1'H-1,4'-bipyrazole Basic information |
| Product Name: | 5-(Di(adamantan-1-yl)phosphino)-1',3',5'-triphenyl-1'H-1,4'-bipyrazole | | Synonyms: | 5-[Di(1-adaMantyl)phosphino](1,3,5-triphenyl-1H-pyrazol-4-yl)-1H-pyrazole, 97+% (AdaMantyl-BippyPhos);5-[Bis(1-adamantyl)phosphino]-1′,3′,5′-triphenyl-1,4′-bi-1H-pyrazole;5-[Di(1-adamantyl)phosphino]-1′,3′,5′-triphenyl-1′H-[1,4′]bipyrazole;Adamantyl-BippyPhos;5-[Di(1-adamantyl)phosphino]-1',3',5'-triphenyl-1'H-[1,4']bipyrazole 97%;5-[Di(1-adamantyl)phosphino](1,3,5-triphenyl-1H-pyrazol-4-yl)-1H-pyrazole, (Adamantyl-BippyPhos);5-[bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino]-
1',3',5'-triphenyl-1,4'-Bi-1H-pyrazole;1,4'-Bi-1H-pyrazole, 5-[bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino]-1',3',5'-triphenyl- | | CAS: | 1239478-87-5 | | MF: | C44H47N4P | | MW: | 662.84 | | EINECS: | | | Product Categories: | | | Mol File: | 1239478-87-5.mol |  |
| | 5-(Di(adamantan-1-yl)phosphino)-1',3',5'-triphenyl-1'H-1,4'-bipyrazole Chemical Properties |
| Melting point | 295-300°C | | storage temp. | 2-8°C | | form | solid | | pka | -0.58±0.19(Predicted) | | color | white to light yellow | | InChIKey | IHFBOUNFWVRWAQ-GOSCEEDCSA-N | | SMILES | C1[C@@H]2C[C@@H]3C[C@H]1C[C@](C2)(C3)P(c4ccnn4-c5c(nn(-c6ccccc6)c5-c7ccccc7)-c8ccccc8)[C@@]9%10C[C@@H]%11C[C@@H](C[C@@H](C%11)C9)C%10 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids |
| | 5-(Di(adamantan-1-yl)phosphino)-1',3',5'-triphenyl-1'H-1,4'-bipyrazole Usage And Synthesis |
| Uses | 5-[Di(1-adamantyl)phosphino](1,3,5-triphenyl-1H-pyrazol-4-yl)-1H-pyrazole can be used as a catalyst. | | Uses | 5-[Di(1-adamantyl)phosphino]-1′,3′,5′-triphenyl-1′H-[1,4′]bipyrazole (Ad-BippyPhos) is an effective ligand that catalyzes C-O coupling reactions of aryl and heteroaryl bromides/chlorides with primary aliphatic alcohols. It can also be used as a catalyst in the synthesis of fluorinated anilines by coupling fluoroalkylamines with aryl bromides and chlorides. | | reaction suitability | reagent type: ligand |
| | 5-(Di(adamantan-1-yl)phosphino)-1',3',5'-triphenyl-1'H-1,4'-bipyrazole Preparation Products And Raw materials |
|