| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 manufacturers
|
| | 25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 Basic information |
| Product Name: | 25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 | | Synonyms: | 25-HydroxyvitaMin D3-[D3]
Calcifediol-D3;25-Hydroxyvitamin D3-[D3] (CertiMass solution);25-Hydroxyvitamin D3-[d3] (Solution);25-Hydroxyvitamin D3 (6,19,19-d3) >=97 atom % D, >=98% (CP);25-hydroxy-5Z-(6,19,19'-2H3)vitaminD3;25-hydroxy VD3-D3;1H-Indene-1-pentanol, 4-[(2Z)-2-[(5S)-5-hydroxy-2-(methylene-d2)cyclohexylidene]ethylidene-2-d]octahydro-α,α,ε,7a-tetramethyl-, (εR,1R,3aS,4E,7aR)-;2H3]-25-HydroxyVitamin D3 | | CAS: | 140710-94-7 | | MF: | C27H41D3O2 | | MW: | 403.66 | | EINECS: | | | Product Categories: | | | Mol File: | 140710-94-7.mol | ![25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 Structure](CAS/20211123/GIF/140710-94-7.gif) |
| | 25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 Chemical Properties |
| Fp | 14°C | | storage temp. | -20°C | | form | Solid | | color | White to light yellow | | Major Application | detection | | InChIKey | JWUBBDSIWDLEOM-CMMPNOGOSA-N | | SMILES | C[C@]12CCC/C(/[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C)=C\C(\[2H])=C1\C[C@H](CC\C\1=C(/[2H])\[2H])O | | CAS Number Unlabeled | 19356-17-3 |
| RIDADR | UN1170 - class 3 - PG 2 - Ethanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 |
| | 25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 Usage And Synthesis |
| Uses | 25-Hydroxyvitamin D3 (6,19,19-d3) can be used as an analytical standard. | | Uses | 25-Hydroxyvitamin D3(6,19,19-d3) can be used as an analytical standard for the quantitative analysis of hydroxyvitamin D3concentration in human serum via LC-MS. | | General Description | 25-Hydroxyvitamin D3 (calcifediol) is a prohormone produced via hydroxylation of vitamin D3 (cholecalciferol) in the liver. It is a precursor for the synthesis of calcitriol {1,25-dihydroxyvitamin D3 or [1,25(OH)2D3]}. It is also used as a biomarker to determine the status of vitamin D in the body. 25-Hydroxyvitamin D3(6,19,19-d3) is a deuterated 25-hydroxyvitamin D3 wherein C-6 and C-19 protons are replaced by deuterium. |
| | 25-HydroxyvitaMin D3-[D3]
Calcifediol-D3 Preparation Products And Raw materials |
|