| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Probucol-(propyl-13C3) CAS:1173019-29-8 Purity:99 atom % 13C, 98% (CP) Package:50MG Remarks:705802-50MG
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Probucol-(propyl-¹³C₃) CAS:1173019-29-8 Purity:>=99 atom% 13C,>=96% Package:1mg;5mg;10mg Remarks:B54449
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:Probucol-(propyl-13C3) 99 atom % 13C, 98% (CP) CAS:1173019-29-8 Purity:98% (CP) Package:10mg;50mg Remarks:NULL
|
| Company Name: |
Qingdao Tenglong microwave technology co., LTD.
|
| Tel: |
0532-83818797 18561885118 |
| Email: |
market@tlwb.com.cn |
| Products Intro: |
Product Name:PROBUCOL (PROPYL-13C3, 99%) CHEMICAL PURITY 96% CAS:1173019-29-8 Purity:96% Package:0.01G;0.05G Remarks:CLM-10557-0.05
|
|
| | Probucol-[13C3] Basic information |
| Product Name: | Probucol-[13C3] | | Synonyms: | PROBUCOL (PROPYL-13C3, 99%) CHEMICAL PURITY 96%;Probucol-(propyl-13C3) 99 atom % 13C, 98% (CP);Probucol-(propyl-13C3);Probucol-(propyl-13C?);Probucol-(propyl-13C3);Probucol-[13C3] (Standard) | | CAS: | 1173019-29-8 | | MF: | C28C3H48O2S2 | | MW: | 0 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File | ![Probucol-[13C3] Structure]() |
| | Probucol-[13C3] Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChI | 1S/C31H48O2S2/c1-27(2,3)21-15-19(16-22(25(21)32)28(4,5)6)34-31(13,14)35-20-17-23(29(7,8)9)26(33)24(18-20)30(10,11)12/h15-18,32-33H,1-14H3/i13+1,14+1,31+1 | | InChIKey | FYPMFJGVHOHGLL-DGVNISHSSA-N | | SMILES | CC(C)(C)c1cc(S[13C]([13CH3])([13CH3])Sc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)cc(c1O)C(C)(C)C | | CAS Number Unlabeled | 23288-49-5 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | Probucol-[13C3] Usage And Synthesis |
| Uses | Probucol-13C3 is the 13C-labeled Probucol. Probucol (DH-581) is an anti-hyperlipidemic agent by lowering the level of cholesterol in the bloodstream by increasing the rate of LDL catabolism. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 [2] Probucol |
| | Probucol-[13C3] Preparation Products And Raw materials |
|