|
|
| | 1,1,7,7-tetramethyl-8-methoxyjulolidine Basic information |
| Product Name: | 1,1,7,7-tetramethyl-8-methoxyjulolidine | | Synonyms: | 1,1,7,7-tetramethyl-8-methoxyjulolidine;1H,5H-Benzo[ij]quinolizine, 2,3,6,7-tetrahydro-8-methoxy-1,1,7,7-tetramethyl-;1,1,7,7-tetramethyl-8-methoxyjulolidine ISO 9001:2015 REACH;1,1,7,7-tetramethyl-8-methoxyxyjulolidine | | CAS: | 1073190-53-0 | | MF: | C17H25NO | | MW: | 259.39 | | EINECS: | | | Product Categories: | | | Mol File: | 1073190-53-0.mol |  |
| | 1,1,7,7-tetramethyl-8-methoxyjulolidine Chemical Properties |
| Boiling point | 355.7±42.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | pka | 6.24±0.60(Predicted) | | InChI | InChI=1S/C17H25NO/c1-16(2)8-10-18-11-9-17(3,4)14-13(19-5)7-6-12(16)15(14)18/h6-7H,8-11H2,1-5H3 | | InChIKey | XBBDHRQDFILWDZ-UHFFFAOYSA-N | | SMILES | C12=CC=C(OC)C3=C1N(CCC3(C)C)CCC2(C)C |
| | 1,1,7,7-tetramethyl-8-methoxyjulolidine Usage And Synthesis |
| | 1,1,7,7-tetramethyl-8-methoxyjulolidine Preparation Products And Raw materials |
|