|
|
| | Baicalin methyl ester Basic information |
| Product Name: | Baicalin methyl ester | | Synonyms: | Baicalin methyl ester;5,6-Dihydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl beta-D-glucopyranosiduronic acid methyl ester;β-D-Glucopyranosiduronic acid, 5,6-dihydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl, methyl ester;Inhibitor,Baicalin methyl ester,inhibit;Methyl (2S,3S,4S,5R,6S)-6-((5,6-dihydroxy-4-oxo-2-phenyl-4H-chromen-7-yl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylate;Baicalin methyl ester, 10 mM in DMSO | | CAS: | 82475-03-4 | | MF: | C22H20O11 | | MW: | 460.39 | | EINECS: | | | Product Categories: | | | Mol File: | 82475-03-4.mol |  |
| | Baicalin methyl ester Chemical Properties |
| Melting point | 268-270 °C | | Boiling point | 754.5±60.0 °C(Predicted) | | density | 1.631±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 5.90±0.40(Predicted) | | color | Light yellow to yellow | | InChIKey | AOWRAYJMTOYETH-BPZKQFRZNA-N | | SMILES | O1[C@@H](OC2=CC3OC(C4=CC=CC=C4)=CC(=O)C=3C(O)=C2O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1C(OC)=O |&1:1,22,24,26,28,r| |
| | Baicalin methyl ester Usage And Synthesis |
| Uses | Baicalin methyl ester is a constituent of the roots of S. baicalmsis[1]. | | target | Antifection | | References | [1] KazutakaNishikawa, et al. Flavonoids in root cultures of Scutellaria baicalensis. Journal of Plant Physiology. 1997, 151(5): 633-636. |
| | Baicalin methyl ester Preparation Products And Raw materials |
|