- 4-Hexyloxybenzoic acid
-
- $0.00 / 1KG
-
2025-12-24
- CAS:1142-39-8
- Min. Order: 1KG
- Purity: 99.0%
- Supply Ability: 10tons
- p-Hexyloxybenzoic Acid
-
- $2.20 / 50kg
-
2025-10-13
- CAS:1142-39-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- 4-Hexyloxybenzoic acid
-
- $5.00 / 5ASSAYS
-
2019-08-06
- CAS:1142-39-8
- Min. Order: 1ASSAYS
- Purity: 99%
- Supply Ability: 1ton
|
| | 4-Hexyloxybenzoic acid Basic information |
| | 4-Hexyloxybenzoic acid Chemical Properties |
| Melting point | 105-153 °C(lit.) | | Boiling point | 323.46°C (rough estimate) | | density | 1.0850 (rough estimate) | | refractive index | 1.4940 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | form | powder to crystal | | pka | 4.49±0.10(Predicted) | | color | White to Almost white | | BRN | 2210618 | | InChI | InChI=1S/C13H18O3/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h6-9H,2-5,10H2,1H3,(H,14,15) | | InChIKey | HBQUXMZZODHFMJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OCCCCCC)C=C1 | | CAS DataBase Reference | 1142-39-8(CAS DataBase Reference) | | NIST Chemistry Reference | 4-(Hexyloxy)benzoic acid(1142-39-8) | | EPA Substance Registry System | Benzoic acid, 4-(hexyloxy)- (1142-39-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29189900 |
| | 4-Hexyloxybenzoic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | Intermediates of Liquid Crystals |
| | 4-Hexyloxybenzoic acid Preparation Products And Raw materials |
|