| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Colby trifluoromethylation reagent Basic information |
| Product Name: | Colby trifluoromethylation reagent | | Synonyms: | Colby trifluoromethylation reagent;Hexafluoroacetone hydrate-1,8-diazo-bicyclo[5.4.0]undec-7-ene salt;Hexafluoroacetone hydrate-1,8-diazo-bicyclo[5.4.0]undec-7-ene salt AldrichCPR;1,1,1,3,3,3-Hexafluoropropane-2,2-diol-1,8-diazo-bicyclo[5.4.0]undec-7-ene salt | | CAS: | 1400691-55-5 | | MF: | C12H18F6N2O2 | | MW: | 336.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1400691-55-5.mol |  |
| | Colby trifluoromethylation reagent Chemical Properties |
| form | solid | | SMILES | OC([O-])(C(F)(F)F)C(F)(F)F.C1CCC2=[N+](CC1)CCCN2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | Colby trifluoromethylation reagent Usage And Synthesis |
| Uses | The Colby Trifluoromethylation Reagent is an air-stable, white solid, which can be used as a source of fluoroform through the release of trifluoroacetate. This reagent can add trifluoromethyl groups in a nucleophlic fashion to carbonyls and sulfides. | | General Description | Colby trifluoromethylation reagent is an amidinate salt of hexafluoroacetone hydrate. This reagent can be prepared from the ethereal solution of hexafluoroacetone trihydrate. It undergoes various trifluoromethylation reactions with electrophiles under different reaction conditions to afford trifluoromethylated products. |
| | Colby trifluoromethylation reagent Preparation Products And Raw materials |
|