| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Company Name: |
TCI AMERICA |
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
|
| | Ethyne-1,2-diyldiboronic acid dipinacol ester Basic information |
| Product Name: | Ethyne-1,2-diyldiboronic acid dipinacol ester | | Synonyms: | Acetylene-1,2-diyl bis(boronic acid pinacol ester);Ethyne-1,2-diyl bis(boronic acid pinacol ester);Ethyne-1,2-diyldiboronic acid dipinacol ester;1,2-bis(4',4',5',5'-tetramethyl[1',3',2']dioxaborolan-2'-yl)acetylene;1,2-Ethynediboronic acid Bis(pinacol) Ester;1,3,2-Dioxaborolane, 2,2'-(1,2-ethynediyl)bis[4,4,5,5-tetramethyl-;*Terbufos Impurity 7 (Phorate Sulfoxide);1,2-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyne | | CAS: | 1010840-17-1 | | MF: | C14H24B2O4 | | MW: | 277.96 | | EINECS: | | | Product Categories: | | | Mol File: | 1010840-17-1.mol |  |
| | Ethyne-1,2-diyldiboronic acid dipinacol ester Chemical Properties |
| Melting point | 269°C | | Boiling point | 257.5±23.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder to crystal | | color | White to Almost white | | InChI | 1S/C14H24B2O4/c1-11(2)12(3,4)18-15(17-11)9-10-16-19-13(5,6)14(7,8)20-16/h1-8H3 | | InChIKey | FABDBLONUBCKBB-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)C#CB2OC(C)(C)C(C)(C)O2 |
| WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 13 - Non Combustible Solids |
| | Ethyne-1,2-diyldiboronic acid dipinacol ester Usage And Synthesis |
| Uses | Reactant for the preparation of:
- Poly(p-phenyleneethynylene)s (PPEs), which are used in constructing organic light-emitting diodes (OLEDs), field-effect transistors (FETs) and several other materials used in electronic devices
|
| | Ethyne-1,2-diyldiboronic acid dipinacol ester Preparation Products And Raw materials |
|