| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Chloro{2,6-bis[(phenylseleno-Se)methyl]phenyl-C}palladium(II) Basic information |
| | Chloro{2,6-bis[(phenylseleno-Se)methyl]phenyl-C}palladium(II) Chemical Properties |
| Melting point | 162-221°C | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C20H17Se2.ClH.Pd/c1-3-10-19(11-4-1)21-15-17-8-7-9-18(14-17)16-22-20-12-5-2-6-13-20;;/h1-13H,15-16H2;1H;/q;;+1/p-1 | | InChIKey | UPTIBUSNQPQCIY-UHFFFAOYSA-M | | SMILES | Cl[Pd]c1c(C[Se]c2ccccc2)cccc1C[Se]c3ccccc3 |
| Hazard Codes | T | | Risk Statements | 23/24/25-40 | | Safety Statements | 36/37-45 | | RIDADR | UN 3283 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
STOT RE 2 |
| | Chloro{2,6-bis[(phenylseleno-Se)methyl]phenyl-C}palladium(II) Usage And Synthesis |
| Uses | Application Statement: Complex promotes the formation of alpha-amino acids and allyl alcohols through a Petasis Borono-Mannich reaction. | | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | Chloro{2,6-bis[(phenylseleno-Se)methyl]phenyl-C}palladium(II) Preparation Products And Raw materials |
|