| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | MIDA021 Basic information |
| Product Name: | MIDA021 | | Synonyms: | MIDA021;5-Bromopyridine-2-boronic acid MIDA ester 95% (HPLC);5-Bromopyridine-2-boronic acid MIDA ester;8-(5-Bromopyridin-2-yl)-4-methyldihydro-4λ4,8λ4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione;Boron, (5-bromo-2-pyridinyl)[N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κN,κO]-, (T-4)- | | CAS: | 1227700-50-6 | | MF: | C10H10BBrN2O4 | | MW: | 312.91 | | EINECS: | | | Product Categories: | | | Mol File: | 1227700-50-6.mol |  |
| | MIDA021 Chemical Properties |
| Melting point | 220-225°C (decomposition) | | form | solid | | InChI | 1S/C10H10BBrN2O4/c1-14-5-9(15)17-11(18-10(16)6-14)8-3-2-7(12)4-13-8/h2-4H,5-6H2,1H3 | | InChIKey | RSJASKKCIPMBEE-UHFFFAOYSA-N | | SMILES | BrC1=CC=C(B2OC(CN(C)CC(O2)=O)=O)N=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | MIDA021 Usage And Synthesis |
| Uses | The 2-substituted pyridinyl boronic acid has classically been a challenging motif to install, due to instability of the boronic acid. The MIDA Boronate now enables a highly effecient means of installing the 2-pyridyl motif through Suzuki-Miyuara coupling.
A General Solution for the 2-Pyridyl Problem |
| | MIDA021 Preparation Products And Raw materials |
|