|
|
| | N,N'-DIFURFURYLOXAMIDE Basic information |
| Product Name: | N,N'-DIFURFURYLOXAMIDE | | Synonyms: | N,N'-DIFURFURYLOXAMIDE;N1,N2-bis(furan-2-ylmethyl)oxalamide;BFMO;N,N'-bis(furan-2-ylmethyl)oxamide;Ethanediamide, N1,N2-bis(2-furanylmethyl)-;N,N'-bis[(furan-2-yl)methyl]ethanediamide;N1,?N2-?bis(2-?furanylmethyl)?- Ethanediamide;VortioxetineImpurity87 | | CAS: | 69010-90-8 | | MF: | C12H12N2O4 | | MW: | 248.23 | | EINECS: | | | Product Categories: | | | Mol File: | 69010-90-8.mol |  |
| | N,N'-DIFURFURYLOXAMIDE Chemical Properties |
| Melting point | 172-174 °C | | density | 1.283±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 11.61±0.46(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C12H12N2O4/c15-11(13-7-9-3-1-5-17-9)12(16)14-8-10-4-2-6-18-10/h1-6H,7-8H2,(H,13,15)(H,14,16) | | InChIKey | XRURWFXKCKASSN-UHFFFAOYSA-N | | SMILES | C(NCC1=CC=CO1)(=O)C(NCC1=CC=CO1)=O |
| | N,N'-DIFURFURYLOXAMIDE Usage And Synthesis |
| Uses | N,N'-DIFURFURYLOXAMIDE(BFMO) is a ligand for the copper-catalyzed coupling of aryl halides and nitrogen heterocycles. |
| | N,N'-DIFURFURYLOXAMIDE Preparation Products And Raw materials |
|