| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4′-Mercapto-[1,1′-biphenyl]-4-carbonitrile Basic information |
| | 4′-Mercapto-[1,1′-biphenyl]-4-carbonitrile Chemical Properties |
| Melting point | 127-132°C | | Boiling point | 384.5±35.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 6.06±0.10(Predicted) | | form | powder | | InChI | 1S/C13H9NS/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8,15H | | InChIKey | ZZSHJNKMDIZSFY-UHFFFAOYSA-N | | SMILES | Sc1ccc(cc1)-c2ccc(cc2)C#N |
| Hazard Codes | Xi,N | | Risk Statements | 41-50 | | Safety Statements | 26-39-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Dam. 1 |
| | 4′-Mercapto-[1,1′-biphenyl]-4-carbonitrile Usage And Synthesis |
| Uses | This material is used to tune the electronic properties and subsequent surface coverage of gold surfaces/monolayer. |
| | 4′-Mercapto-[1,1′-biphenyl]-4-carbonitrile Preparation Products And Raw materials |
|