| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 4-Fluoro-D-mandelic acid Basic information |
| Product Name: | 4-Fluoro-D-mandelic acid | | Synonyms: | (R)-4-Fluoromandelic acid;4-Fluoro-D-mandelic acid;(R)-4-Fluoromandelic acid ChiPros(R), produced by BASF, 98%;Benzeneacetic acid, 4-fluoro-α-hydroxy-, (αR)-;(R)-4-Fluoromandelic acid;(2R)-2-(4-Fluorophenyl)-2-hydroxyacetic acid;(R)-2-(4-Fluorophenyl)-2-hydroxyacetic acid - [F90857] | | CAS: | 32222-45-0 | | MF: | C8H7FO3 | | MW: | 170.14 | | EINECS: | | | Product Categories: | | | Mol File: | 32222-45-0.mol |  |
| | 4-Fluoro-D-mandelic acid Chemical Properties |
| Boiling point | 322.4±27.0 °C(Predicted) | | density | 1.425±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.17±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C8H7FO3/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,10H,(H,11,12)/t7-/m1/s1 | | InChIKey | RWCMOQXHIDWDDJ-SSDOTTSWSA-N | | SMILES | O[C@@H](C(O)=O)C1=CC=C(F)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Fluoro-D-mandelic acid Usage And Synthesis |
| | 4-Fluoro-D-mandelic acid Preparation Products And Raw materials |
|