| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE
CAS:3369-39-9
|
1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE manufacturers
|
| | 1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE Basic information |
| Product Name: | 1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE | | Synonyms: | AKOS B001443;AKOS MSC-0032;1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE;1-(1-NAPHTHALENYL)-1H-PYRROLE-2,5-DIONE;ASISCHEM D48964;ART-CHEM-BB B001443;AURORA 13681;N-(Naphthalen-1-yl)maleimide | | CAS: | 3369-39-9 | | MF: | C14H9NO2 | | MW: | 223.23 | | EINECS: | | | Product Categories: | | | Mol File: | 3369-39-9.mol |  |
| | 1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE Chemical Properties |
| Melting point | 116-117 °C | | Boiling point | 405.8±14.0 °C(Predicted) | | density | 1.358±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -1.21±0.20(Predicted) | | Appearance | Brown to dark brown Solid | | InChI | InChI=1S/C14H9NO2/c16-13-8-9-14(17)15(13)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H | | InChIKey | BAWHYOHVWHQWFQ-UHFFFAOYSA-N | | SMILES | N1(C2=C3C(C=CC=C3)=CC=C2)C(=O)C=CC1=O | | CAS DataBase Reference | 3369-39-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE Usage And Synthesis |
| | 1-NAPHTHALEN-1-YL-PYRROLE-2,5-DIONE Preparation Products And Raw materials |
|