|
|
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Basic information |
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Chemical Properties |
| Melting point | 305 °C (dec.)(lit.) | | Boiling point | 403.6±28.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.65±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C10H8N2O2/c13-10(14)8-1-3-9(4-2-8)12-6-5-11-7-12/h1-7H,(H,13,14) | | InChIKey | LFIDZIWWYNTQOQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(N2C=NC=C2)C=C1 | | CAS DataBase Reference | 17616-04-5(CAS DataBase Reference) |
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Usage And Synthesis |
| Uses | The series of difunctional organic linkers combining anionic carboxylates and neutral 1H-imidazol-1-yl donors such as 4-(1H-imidazol-1-yl)benzoic acid (HIBA) and 3,5-di(imidazol-1-yl)benzoic acid, which are employed as good candidates for the construction of MOFs[1]. | | References | [1] Chen, S.-S., Liu, Q., Zhao, Y., Qiao, R., Sheng, L.-Q., Liu, Z.-D., Yang, S., & Song, C.-F. (2014). New Metal–Organic Frameworks Constructed from the 4-Imidazole-Carboxylate Ligand: Structural Diversities, Luminescence, and Gas Adsorption Properties. Crystal Growth & Design, 14 8, 3727–3741. https://doi.org/10.1021/cg401811c
|
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Preparation Products And Raw materials |
|