|
|
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Basic information |
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Chemical Properties |
| Melting point | 305 °C (dec.)(lit.) | | Boiling point | 403.6±28.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.65±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C10H8N2O2/c13-10(14)8-1-3-9(4-2-8)12-6-5-11-7-12/h1-7H,(H,13,14) | | InChIKey | LFIDZIWWYNTQOQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(N2C=NC=C2)C=C1 | | CAS DataBase Reference | 17616-04-5(CAS DataBase Reference) |
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Usage And Synthesis |
| | 4-(1H-IMIDAZOL-1-YL)BENZOIC ACID Preparation Products And Raw materials |
|