|
|
| | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde Basic information |
| Product Name: | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde | | Synonyms: | 3,5-;3,5-4-;3,5-di-tert-butyl-4-hydroxy-benzaldehyd;4-Formyl-2,6-di-tert-butylphenol;Benzaldehyde, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-;Benzaldehyde, 3,5-di-tert-butyl-4-hydroxy-;Benzaldehyde, 4-hydroxy-3,5-di-tert.-butyl;Benzoic aldehyde, 3,5-di-t-butyl-4-hydroxy- | | CAS: | 1620-98-0 | | MF: | C15H22O2 | | MW: | 234.33 | | EINECS: | 216-592-0 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted);bc0001;Intermediates | | Mol File: | 1620-98-0.mol |  |
| | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde Chemical Properties |
| Melting point | 186-190 °C | | Boiling point | 336.66°C (rough estimate) | | density | 1.0031 (rough estimate) | | refractive index | 1.5542 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in hot methanol. | | pka | 8.33±0.40(Predicted) | | form | Crystalline Powder | | color | Light yellow to yellow-beige | | Sensitive | Air Sensitive | | BRN | 982526 | | Stability: | Hygroscopic | | InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-9,17H,1-6H3 | | InChIKey | DOZRDZLFLOODMB-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 | | CAS DataBase Reference | 1620-98-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde(1620-98-0) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-36-25 | | Safety Statements | 24/25-45-26-36/37 | | WGK Germany | WGK 3 | | RTECS | CU5610070 | | Hazard Note | Irritant | | HS Code | 29124990 | | Storage Class | 11 - Combustible Solids |
| | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde Usage And Synthesis |
| Chemical Properties | light yellow to yellow-beige crystalline powder | | Uses | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde is employed as an OLED materials. It is also used as a pharmaceutical intermediate. The derivatives of this compound possess equipotent anti-inflammatory activities to indomethacin. | | Definition | ChEBI: 3,5-di-tert-Butyl-4-hydroxybenzaldehyde is a hydroxybenzaldehyde. |
| | 3,5-Di-tert-butyl-4-hydroxybenzaldehyde Preparation Products And Raw materials |
| Raw materials | Benzeneacetic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, methyl ester-->Benzene, 5-bromo-1,3-bis(1,1-dimethylethyl)-2-[(trimethylsilyl)oxy]--->Hexamethylenetetramine | | Preparation Products | 3,3',5,5'-TETRA-TERT-BUTYL-4,4'-STILBENEQUINONE-->3,5-Di-tert-butyl-4-hydroxybenzyl alcohol-->3,5-Di-tert-butyl-4-hydroxybenzoic acid-->2-Ethoxyphenol-->3,5-Di-tert-butylcatechol-->4,4'-(2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diyl)bis[2,6-di-tert-butylphenol]-->2-Propenoic acid, 3-[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]-, (2E)--->(Z)-5-(3,5-di-tert-butyl-4-hydroxybenzylidene)-2-thioxothiazolidin-4-one-->2(3H)-Furanone, 3-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]dihydro-, (E)- |
|