- 2-BROMO-5-IODOTOLUENE
-
- $0.00 / 1KG
-
2026-03-30
- CAS:202865-85-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 2000
- 2-Bromo-5-iodotoluene
-
- $0.00 / 1KG
-
2025-04-04
- CAS:202865-85-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1Ton
|
| | 2-BROMO-5-IODOTOLUENE Basic information |
| | 2-BROMO-5-IODOTOLUENE Chemical Properties |
| Boiling point | 148°C 20mm | | density | 2,07 g/cm3 | | refractive index | 1.6500 | | Fp | 114℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | color | Light orange to Yellow to Green | | Specific Gravity | 2.07 | | Sensitive | Light Sensitive | | BRN | 8760525 | | InChI | InChI=1S/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 | | InChIKey | QSQOGKONVJDRNH-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(I)C=C1C | | CAS DataBase Reference | 202865-85-8(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-BROMO-5-IODOTOLUENE Usage And Synthesis |
| Chemical Properties | light yellow liquid |
| | 2-BROMO-5-IODOTOLUENE Preparation Products And Raw materials |
|