|
|
| | 4-METHYL-MORPHOLINEBORANE Basic information |
| Product Name: | 4-METHYL-MORPHOLINEBORANE | | Synonyms: | 4-METHYL-MORPHOLINEBORANE;BORANE-4-METHYLMORPHOLINE COMPLEX;Boron, trihydro(4-methylmorpholine-.kappa.N4)-, (T-4)-;Borane 4-methylmorpholine;4-methylmorpholine - borane (1/1);Borane 4-MethylMorpholine coMplex 97%;Borane-N-methylmorpholine complex;Borane-4-methyL | | CAS: | 15648-16-5 | | MF: | C5H14BNO | | MW: | 114.98 | | EINECS: | | | Product Categories: | | | Mol File: | 15648-16-5.mol |  |
| | 4-METHYL-MORPHOLINEBORANE Chemical Properties |
| Melting point | 42-45 °C (lit.) | | Fp | 151 °F | | form | Solid | | InChI | InChI=1S/C5H14BNO/c1-7(6)2-4-8-5-3-7/h2-5H2,1,6H3 | | InChIKey | HEOFHMZUMVDLFB-UHFFFAOYSA-N | | SMILES | [B+3](N1(CCOCC1)C)([H-])([H-])[H-] |
| | 4-METHYL-MORPHOLINEBORANE Usage And Synthesis |
| Uses | Reagent for:
- Labeling oligosaccharides for quantitative mass spectrometry
- Analysis of sugar markers associated with Bacillus anthracis spores after culture
- Synthesis of sulfated red seaweed galactan derived disaccharide alditol
- Analysis of sulfated galactans from red algae by reductive hydrolysis and mild methanolysis by HPLC
Reactant for methanolic cleavage
Used in reductive pyrolysis of carrageenan by high performance anion-exchange chromatography | | reaction suitability | reagent type: reductant |
| | 4-METHYL-MORPHOLINEBORANE Preparation Products And Raw materials |
|