| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,4,6-Trichlorobenzenesulfonyl fluoride Basic information |
| | 2,4,6-Trichlorobenzenesulfonyl fluoride Chemical Properties |
| density | 1.655 g/mL at 25 °C | | refractive index | n20/D 1.568 | | Fp | >110 °C | | form | liquid | | InChI | 1S/C6H2Cl3FO2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H | | InChIKey | YIYMNRBLYKOKQM-UHFFFAOYSA-N | | SMILES | FS(C1=C(Cl)C=C(Cl)C=C1Cl)(=O)=O |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 2,4,6-Trichlorobenzenesulfonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | 2,4,6-Trichlorobenzenesulfonyl fluoride Preparation Products And Raw materials |
|