|
|
| | 2-Bromo-4,6-difluoroanisole Basic information |
| Product Name: | 2-Bromo-4,6-difluoroanisole | | Synonyms: | BUTTPARK 20\04-77;2-BROMO-4,6-DIFLUOROANISOLE;1-Bromo-3,5-difluoro-2-methoxy-benzene;1-Bromo-3,5-difluoro-2-methoxybenzene, 2-Bromo-4,6-difluorophenyl methyl ether;2-Bromo-4,6-difluoroanisole99%;Benzene, 1-bromo-3,5-difluoro-2-methoxy-;2-Bromo-4,6-difluoroanisole ISO 9001：2015 REACH;2-bromo-4,6-difluorobenzyl ether | | CAS: | 202865-59-6 | | MF: | C7H5BrF2O | | MW: | 223.01 | | EINECS: | | | Product Categories: | Ethers;Organic Building Blocks;Oxygen Compounds;Anisoles, Alkyloxy Compounds & Phenylacetates;Bromine Compounds;Fluorine Compounds;Anisole;Aromatic Halides (substituted) | | Mol File: | 202865-59-6.mol |  |
| | 2-Bromo-4,6-difluoroanisole Chemical Properties |
| Boiling point | 212.9±35.0 °C(Predicted) | | density | 1.615±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.5040(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H5BrF2O/c1-11-7-5(8)2-4(9)3-6(7)10/h2-3H,1H3 | | InChIKey | MFXWQGHKLXJIIP-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(F)=CC(F)=C1OC | | CAS DataBase Reference | 202865-59-6(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2909309090 |
| | 2-Bromo-4,6-difluoroanisole Usage And Synthesis |
| Uses | 2-Bromo-4,6-difluoroanisole is an organic compound, commonly used as a pharmaceutical, pesticide intermediate and organic synthesis raw material. |
| | 2-Bromo-4,6-difluoroanisole Preparation Products And Raw materials |
|