- 5-Amino-2-hydroxypyridine
-
- $15.00 / 1KG
-
2021-07-13
- CAS:33630-94-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 5-Amino-2-hydroxypyridine Basic information |
| | 5-Amino-2-hydroxypyridine Chemical Properties |
| Melting point | ca 180℃ | | Boiling point | 206.4°C (rough estimate) | | density | 1.208 | | refractive index | 1.4800 (estimate) | | storage temp. | Refrigerated. | | form | powder | | pka | 12.87±0.10(Predicted) | | color | Black | | InChI | InChI=1S/C5H6N2O/c6-4-1-2-5(8)7-3-4/h1-3H,6H2,(H,7,8) | | InChIKey | GDOIKKMNCIMDAO-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(N)C=C1 | | CAS DataBase Reference | 33630-94-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-40-22-36 | | Safety Statements | 22-26-36 | | WGK Germany | WGK 3 | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 5-Amino-2-hydroxypyridine Usage And Synthesis |
| Uses | 5-Amino-2-hydroxypyridine is mainly used as a raw material for organic synthesis and can be used in the preparation of pyrazole amides, electrode materials and dendritic polymers, among other products. |
| | 5-Amino-2-hydroxypyridine Preparation Products And Raw materials |
|