|
|
| | (S,S)-2,6-BIS(4-ISOPROPYL-2-OXAZOLIN-2-YL)PYRIDINE Basic information | | Reaction |
| Product Name: | (S,S)-2,6-BIS(4-ISOPROPYL-2-OXAZOLIN-2-YL)PYRIDINE | | Synonyms: | 2,6-Bis[(4S)-4-isopropyl-2-oxazolin-2-yl]pyridine;2,6-Bis((S);-4-isopropyl-4,5-dihydrooxazol-2-yl);2,6-Bis[(4S)-isopropyl-2-oxazolin-2-yl]pyridine,99%e.e.;2,6-BIS[(4S)-(-)-ISOPROPYL-2-OXAZOLIN-2-YL]PYRIDINE;2,6-Bis[(4S)-(-)-isopropyl-2-oxazolin-2-yl]pyridine ,99%;(S,S)-2,2'-(2,6-PYRIDINEDIYL)BIS(4-ISOPROPYL-2-OXAZOLINE);(S,S)-2,6-BIS(4-ISOPROPYL-2-OXAZOLIN-2-YL)PYRIDINE | | CAS: | 118949-61-4 | | MF: | C17H23N3O2 | | MW: | 301.38 | | EINECS: | | | Product Categories: | organic amine;BOX series;Chiral Nitrogen;Asymmetric Synthesis;Synthetic Organic Chemistry | | Mol File: | 118949-61-4.mol |  |
| | (S,S)-2,6-BIS(4-ISOPROPYL-2-OXAZOLIN-2-YL)PYRIDINE Chemical Properties |
| Melting point | 155-157 °C(lit.) | | alpha | -120° (c 1.0, CH2Cl2) | | Boiling point | 457.1±30.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 3.78±0.70(Predicted) | | form | crystal | | color | white | | Optical Rotation | [α]25/D 118°, c = 0.7 in methylene chloride | | BRN | 5824976 | | InChI | InChI=1S/C17H23N3O2/c1-10(2)14-8-21-16(19-14)12-6-5-7-13(18-12)17-20-15(9-22-17)11(3)4/h5-7,10-11,14-15H,8-9H2,1-4H3/t14-,15-/m1/s1 | | InChIKey | CSGQGLBCAHGJDR-HUUCEWRRSA-N | | SMILES | C1(C2=N[C@@H](C(C)C)CO2)=NC(C2=N[C@@H](C(C)C)CO2)=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids |
| | (S,S)-2,6-BIS(4-ISOPROPYL-2-OXAZOLIN-2-YL)PYRIDINE Usage And Synthesis |
| Reaction |
- Ligand used in the dual-catalyst system for highly enantioselective conjugate cyanation of unsaturated imides.
- Ligand for cross-coupling reactions of iodoalkanes with alkyl zinc halides.
- Ligand for asymmetric 1,4-addition reactions of 1,3-dicarbonyl compounds to nitroalkenes.
- Ligand for asymmetric allylation of aldehydes with b-carbonyl allylstannanes.
- Ligand used in the enantioselective Negishi reaction of racemic secondary benzylic halides.
- Ligand for osmium catalyzed enantioselective transfer hydrogenation.

| | Chemical Properties | White powder or crystal or chunks | | Uses | Used as a ligand to prepare novel ruthenium-pyridine-carboxylate complexes as new catalytic systems for alkene epoxidation. |
| | (S,S)-2,6-BIS(4-ISOPROPYL-2-OXAZOLIN-2-YL)PYRIDINE Preparation Products And Raw materials |
|