|
|
| | 2-PROPANOL-D8 Basic information |
| Product Name: | 2-PROPANOL-D8 | | Synonyms: | 2-PROPANOL-D8;2-PROPANOLE-D8;2-PROPYL ALCOHOL D8;IPA-D8;ISOPROPANOL-D8;ISOPROPYL ALCOHOL-D8;Isopropanol-d8, Octadeuteroisopropanol;(O,1,1,1,2,3,3,3-2H8)propan-2-ol | | CAS: | 22739-76-0 | | MF: | C3D8O | | MW: | 68.14 | | EINECS: | 245-189-2 | | Product Categories: | | | Mol File: | 22739-76-0.mol |  |
| | 2-PROPANOL-D8 Chemical Properties |
| Melting point | -89°C | | Melting point | -89.5°C | | Boiling point | 82 °C(lit.) | | Boiling point | 83°C | | density | d = 0,90 | | density | 0.890 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.3728(lit.) | | Fp | 75 °F | | storage temp. | Flammables area | | form | Liquid | | color | Clear colorless | | explosive limit | 2-12.7%(V) | | Water Solubility | Completely soluble in water. | | BRN | 1816231 | | Stability: | Stable. Highly flammable. Incompatible with acids, strong oxidizing agents, acid anhydrides, halogens, aluminium. | | InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i1D3,2D3,3D,4D | | InChIKey | KFZMGEQAYNKOFK-PIODKIDGSA-N | | SMILES | C([2H])(O[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | F,Xi | | Risk Statements | 11-67-36 | | Safety Statements | 7-16-26-24/25-2017/7/16 | | RIDADR | UN 1219 3/PG 2 | | WGK Germany | 3 | | F | 3-10 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 28459000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | 2-PROPANOL-D8 Usage And Synthesis |
| Chemical Properties | colourless liquid | | Uses | 2-Propanol-d{8} is used as an intermediate in chemical research and in pharmaceutics. | | General Description | 2-Propanol-d8 (Isopropanol-d8) is a deuterated derivative of isopropanol. Generation and decay of correlated radical pairs (SCRP) during the reduction of acetone(D6) in 2-propanol(D8) have been studied by Fourier transform-electron paramagnetic resonance (FT-EPR) spectroscopy. It participates as solvent during the evaluation of triplet decay constants, triplet lifetime and photoreduction rate constants of benzophenone. |
| | 2-PROPANOL-D8 Preparation Products And Raw materials |
|