- 3,4-Difluoronitrobenzene
-
- $0.00 / 1KG
-
2026-02-11
- CAS:369-34-6
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 30tons/month
- 3,4-Difluoronitrobenzene
-
- $8.00 / 1KG
-
2025-09-25
- CAS:369-34-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3,4-Difluoronitrobenzene Basic information |
| Product Name: | 3,4-Difluoronitrobenzene | | Synonyms: | 1,2-difluoro-4-nitro-benzen;Benzene, 1,2-difluoro-4-nitro-;3,4-DIFLUORONITROBENZENE;1,2-DIFLUORO-4-NITROBENZENE;1-NITRO-3,4-DIFLUOROBENZENE;Benzene, 1,2-difluoro-4-nitro- (6CI,7CI,8CI,9CI);1,2-Difluoro-4-nitrobenzene,98+%;3,4-difluoro-1-nitrobenzene | | CAS: | 369-34-6 | | MF: | C6H3F2NO2 | | MW: | 159.09 | | EINECS: | 206-718-2 | | Product Categories: | Fluorine Compounds;Nitro Compounds;Fluorine series;nitro-compound| alkyl Fluorine;HALIDE;Aromatic Halides (substituted) | | Mol File: | 369-34-6.mol |  |
| | 3,4-Difluoronitrobenzene Chemical Properties |
| Melting point | -12C | | Boiling point | 76-80 °C/11 mmHg (lit.) | | density | 1.437 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.509(lit.) | | Fp | 177 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Liquid | | Specific Gravity | 1.437 | | color | Clear yellow | | Water Solubility | insoluble | | BRN | 1944996 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. | | InChI | 1S/C6H3F2NO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H | | InChIKey | RUBQQRMAWLSCCJ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(F)c(F)c1 | | CAS DataBase Reference | 369-34-6(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4-Difluoronitrobenzene(369-34-6) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36/37/39-36 | | RIDADR | 2810 | | WGK Germany | 3 | | RTECS | CZ5710000 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29049090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,4-Difluoronitrobenzene Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 3,4-Difluoronitrobenzene was used in the preparation of xanthones and acridones. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 63, p. 8448, 1998 DOI: 10.1021/jo981557o | | General Description | The experimental and computational thermochemical study of 3,4-difluoronitrobenzene was studied. |
| | 3,4-Difluoronitrobenzene Preparation Products And Raw materials |
|