| Company Name: |
Suzhou haiyu Biochem Industrial Co., LTD Gold
|
| Tel: |
512-68097639 18013585858 |
| Email: |
744942877@qq.com |
| Products Intro: |
Product Name:(S)-N-Boc-2-(3-butenyl)glycine
CAS:208522-13-8
Purity:97% Package:100g;1000g;10g
|
| Company Name: |
Okeanos Tech Co,. Ltd.
|
| Tel: |
010-62651721 18610486005 |
| Email: |
minghui.yu@okeanos.com.cn |
| Products Intro: |
Product Name:(S)-N-Boc-2-(3'-butenyl)glycine; Boc-S4-NM
CAS:208522-13-8
Purity:97% Package:1g;5g;10g;25g;
|
|
| | (S)-N-Boc-2-(3'-butenyl)glycine Basic information |
| Product Name: | (S)-N-Boc-2-(3'-butenyl)glycine | | Synonyms: | (S)-N-Boc-2-(3'-butenyl)glycine;Boc-(2S)-2-AMINO-5-HEXENOIC ACID;(2S)-2-(Boc-amino)-5-hexenoic acid;(Tert-Butoxy)Carbonyl L-Homoallylglycine;(2S)-2-{[(tert-butoxy)carbonyl]amino}hex-5-enoic acid;5-Hexenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (2S)-;Boc-Abu(vinyl)-OH;Boc-(S)?-?2-?Amino-?5-?hexenoic acid | | CAS: | 208522-13-8 | | MF: | C11H19NO4 | | MW: | 229.27 | | EINECS: | | | Product Categories: | | | Mol File: | 208522-13-8.mol |  |
| | (S)-N-Boc-2-(3'-butenyl)glycine Chemical Properties |
| Boiling point | 369.1±35.0 °C(Predicted) | | density | 1.078±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 3.96±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H19NO4/c1-5-6-7-8(9(13)14)12-10(15)16-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m0/s1 | | InChIKey | LQIMZUPFMSNHTM-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@@H](NC(OC(C)(C)C)=O)CCC=C |
| | (S)-N-Boc-2-(3'-butenyl)glycine Usage And Synthesis |
| | (S)-N-Boc-2-(3'-butenyl)glycine Preparation Products And Raw materials |
|