|
|
| | Cimetidine hydrochloride Basic information |
| Product Name: | Cimetidine hydrochloride | | Synonyms: | Guanidine, N-cyano-N'-methyl-N''-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]-, monohydrochloride;Cimetidine Hydrochloride (200 mg);cimetex;Guanidine,N-cyano-N’-methyl-N’’-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]-,monohydrochloride;n-cyano-n’-methyl-n’’-(2-(((5-methyl-1h-imidazol-4-yl)methyl)thio)ethyl)-guanidinmonohydrochloride;3-cyano-2-methyl-1-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]guanidine hydrochloride;N-cyano-N'-methyl-N''-[2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethyl]guanidine monohydrochloride;Cimetidine Hydrochloride USP24 | | CAS: | 70059-30-2 | | MF: | C10H17ClN6S | | MW: | 288.8 | | EINECS: | 274-297-2 | | Product Categories: | | | Mol File: | 70059-30-2.mol |  |
| | Cimetidine hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | Freely soluble in water, sparingly soluble in anhydrous ethanol. | | BRN | 5668216 | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C10H16N6S.ClH/c1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11;/h7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14);1H | | InChIKey | QJHCNBWLPSXHBL-UHFFFAOYSA-N | | SMILES | Cl.CN\C(NC#N)=N/CCSCc1nc[nH]c1C | | CAS DataBase Reference | 70059-30-2(CAS DataBase Reference) |
| WGK Germany | 3 | | RTECS | MF0035100 | | HS Code | 2933290000 | | Storage Class | 11 - Combustible Solids |
| | Cimetidine hydrochloride Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder | | Uses | Cimetidine Hydrochloride acts as a competitive histamine H2-receptor antagonist which inhibits gastric acid secretion and reduces pepsin output. | | Uses | Antagonist (to histamine H2receptors). | | Brand name | Tagamet
(GlaxoSmithKline). | | General Description | Cimetidine is a histamine H2-receptor antagonist, widely used to inhibit gastric acid secretion. It finds application in the treatment of gastric and duodenal ulcers. Pharmaceutical secondary standards for application in quality control, provide pharma laboratories and manufacturers with a convenient and cost-effective alternative to the preparation of in-house working standards. |
| | Cimetidine hydrochloride Preparation Products And Raw materials |
|