- 2-Fluoro-4-chloropyridine
-
- $200.00 / 1KG
-
2025-09-25
- CAS:34941-92-9
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-Fluoro-4-chloropyridine Basic information |
| | 2-Fluoro-4-chloropyridine Chemical Properties |
| Boiling point | 155.9±20.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.79±0.10(Predicted) | | form | Solid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C5H3ClFN/c6-4-1-2-8-5(7)3-4/h1-3H | | InChIKey | GNJKJKBURMCLOR-UHFFFAOYSA-N | | SMILES | C1(F)=NC=CC(Cl)=C1 |
| | 2-Fluoro-4-chloropyridine Usage And Synthesis |
| | 2-Fluoro-4-chloropyridine Preparation Products And Raw materials |
|